cas: 5455-59-4 — see every product listed under this CAS number, including other names
2-Nitrobenzenesulfonamide, 99.96% (CAS 5455-59-4) is a chemical reagent available from Chemat. Available pack sizes: 25 g, 100 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W008096-25 g |
| cas | 5455-59-4 |
| size | 25 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 25 g | 240.74 Pln | |
| MedChemExpress | 100 g | 384.71 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.96% |
2-nitrobenzenesulfonamide (CAS 5455-59-4) is a chemical compound with the molecular formula C6H6N2O4S and a molecular weight of 202.19 g/mol. IUPAC name: 2-nitrobenzenesulfonamide. InChIKey: GNDKYAWHEKZHPJ-UHFFFAOYSA-N.
| Molecular formula | C6H6N2O4S |
|---|---|
| Molecular weight | 202.19 g/mol |
| IUPAC name | 2-nitrobenzenesulfonamide |
| InChIKey | GNDKYAWHEKZHPJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)[N+](=O)[O-])S(=O)(=O)N |
Computed by PubChem (NCBI)