2-Nitrobenzophenone 96%
cas: 2243-79-0 — see every product listed under this CAS number, including other names
2-Nitrobenzophenone 96% (CAS 2243-79-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A391547-100mg |
| cas | 2243-79-0 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 225.75 Pln | |
| Ambeed | 250mg | 292.50 Pln | |
| Ambeed | 1g | 487.19 Pln | |
| Ambeed | 5g | 1905.62 Pln |
properties
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A391547 |
(2-nitrophenyl)-phenylmethanone (CAS 2243-79-0) is a chemical compound with the molecular formula C13H9NO3 and a molecular weight of 227.21 g/mol. IUPAC name: (2-nitrophenyl)-phenylmethanone. InChIKey: UJHSIDUUJPTLDY-UHFFFAOYSA-N.
| Molecular formula | C13H9NO3 |
|---|---|
| Molecular weight | 227.21 g/mol |
| IUPAC name | (2-nitrophenyl)-phenylmethanone |
| InChIKey | UJHSIDUUJPTLDY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=CC=C2[N+](=O)[O-] |
Computed by PubChem (NCBI)