CAS 566198-28-5 appears in our catalog under these names: 5–(4–Formylphenyl)nicotinic Acid, 5-(4-Formylphenyl)nicotinic acid, 95%, 5-(4-Formylphenyl)nicotinic acid, 98%, 5-(4-Formylphenyl)nicotinic acid, 97%, 5-(4-Formylphenyl)nicotinic Acid, 95%, 95%. Offered by: GLPBio, Combi-blocks, AmBeed, Fluorochem, Chemat. Available pack sizes: 1g, 5g, 10g, 100mg, 250mg, 25g.
5-(4-formylphenyl)pyridine-3-carboxylic acid (CAS 566198-28-5) is a chemical compound with the molecular formula C13H9NO3 and a molecular weight of 227.21 g/mol. IUPAC name: 5-(4-formylphenyl)pyridine-3-carboxylic acid. InChIKey: HXYMSAUBDZGIRE-UHFFFAOYSA-N.
| Molecular formula | C13H9NO3 |
|---|---|
| Molecular weight | 227.21 g/mol |
| IUPAC name | 5-(4-formylphenyl)pyridine-3-carboxylic acid |
| InChIKey | HXYMSAUBDZGIRE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)C2=CC(=CN=C2)C(=O)O |
Computed by PubChem (NCBI)