Products 147779-25-7

CAS 147779-25-7 is the registry number for 2-Benzoylnicotinic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

2-benzoylpyridine-3-carboxylic acid (CAS 147779-25-7) is a chemical compound with the molecular formula C13H9NO3 and a molecular weight of 227.21 g/mol. IUPAC name: 2-benzoylpyridine-3-carboxylic acid. InChIKey: CUADCEFWXFDKEK-UHFFFAOYSA-N.

Identity
Molecular formulaC13H9NO3
Molecular weight227.21 g/mol
IUPAC name2-benzoylpyridine-3-carboxylic acid
InChIKeyCUADCEFWXFDKEK-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C(=O)C2=C(C=CC=N2)C(=O)O

Computed by PubChem (NCBI)