Products 2437424-27-4
CAS 2437424-27-4 is the registry number for 4-Phenyl-4h-furo[3,2-b]pyrrole-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-phenylfuro[3,2-b]pyrrole-5-carboxylic acid (CAS 2437424-27-4) is a chemical compound with the molecular formula C13H9NO3 and a molecular weight of 227.21 g/mol. IUPAC name: 4-phenylfuro[3,2-b]pyrrole-5-carboxylic acid. InChIKey: PSQIVMNNTFDBBG-UHFFFAOYSA-N.
| Molecular formula | C13H9NO3 |
|---|---|
| Molecular weight | 227.21 g/mol |
| IUPAC name | 4-phenylfuro[3,2-b]pyrrole-5-carboxylic acid |
| InChIKey | PSQIVMNNTFDBBG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C3=C(C=C2C(=O)O)OC=C3 |
Computed by PubChem (NCBI)