Products 1261972-92-2

CAS 1261972-92-2 is the registry number for 3-(4-Formylphenyl)picolinic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

3-(4-formylphenyl)pyridine-2-carboxylic acid (CAS 1261972-92-2) is a chemical compound with the molecular formula C13H9NO3 and a molecular weight of 227.21 g/mol. IUPAC name: 3-(4-formylphenyl)pyridine-2-carboxylic acid. InChIKey: JLBFPCXWHINREB-UHFFFAOYSA-N.

Identity
Molecular formulaC13H9NO3
Molecular weight227.21 g/mol
IUPAC name3-(4-formylphenyl)pyridine-2-carboxylic acid
InChIKeyJLBFPCXWHINREB-UHFFFAOYSA-N
SMILESC1=CC(=C(N=C1)C(=O)O)C2=CC=C(C=C2)C=O

Computed by PubChem (NCBI)