Products 834884-75-2

CAS 834884-75-2 is the registry number for 5-(4-Cyanophenyl)furan-2-carboxylic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

Methyl 5-(4-cyanophenyl)furan-2-carboxylate (CAS 834884-75-2) is a chemical compound with the molecular formula C13H9NO3 and a molecular weight of 227.21 g/mol. IUPAC name: methyl 5-(4-cyanophenyl)furan-2-carboxylate. InChIKey: KXWHTAUZNSVTPO-UHFFFAOYSA-N.

Identity
Molecular formulaC13H9NO3
Molecular weight227.21 g/mol
IUPAC namemethyl 5-(4-cyanophenyl)furan-2-carboxylate
InChIKeyKXWHTAUZNSVTPO-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC=C(O1)C2=CC=C(C=C2)C#N

Computed by PubChem (NCBI)