cas: 861337-74-8 — see every product listed under this CAS number, including other names
2-Nitrophenethylamine hydrochloride, 97%, 97% (CAS 861337-74-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GY97-100mg |
| cas | 861337-74-8 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 184.40 Pln | |
| Chemat | 250mg | 256.40 Pln | |
| Chemat | 1g | 650.00 Pln | |
| Chemat | 5g | 2421.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-(2-nitrophenyl)ethanamine;hydrochloride (CAS 861337-74-8) is a chemical compound with the molecular formula C8H11ClN2O2 and a molecular weight of 202.64 g/mol. IUPAC name: 2-(2-nitrophenyl)ethanamine;hydrochloride. InChIKey: WOSOJVABEIZQDC-UHFFFAOYSA-N.
| Molecular formula | C8H11ClN2O2 |
|---|---|
| Molecular weight | 202.64 g/mol |
| IUPAC name | 2-(2-nitrophenyl)ethanamine;hydrochloride |
| InChIKey | WOSOJVABEIZQDC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CCN)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)