cas: 101654-28-8 — see every product listed under this CAS number, including other names
2-Nitropyridin-4-ol 97% (CAS 101654-28-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A412060-100mg |
| cas | 101654-28-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 437.12 Pln | |
| Ambeed | 250mg | 620.69 Pln | |
| Ambeed | 1g | 1638.62 Pln | |
| Ambeed | 5g | 6027.44 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A412060 |
2-nitro-1H-pyridin-4-one (CAS 101654-28-8) is a chemical compound with the molecular formula C5H4N2O3 and a molecular weight of 140.10 g/mol. IUPAC name: 2-nitro-1H-pyridin-4-one. InChIKey: NJTUZNXKDOUPHP-UHFFFAOYSA-N.
| Molecular formula | C5H4N2O3 |
|---|---|
| Molecular weight | 140.10 g/mol |
| IUPAC name | 2-nitro-1H-pyridin-4-one |
| InChIKey | NJTUZNXKDOUPHP-UHFFFAOYSA-N |
| SMILES | C1=CNC(=CC1=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)