CAS 101654-28-8 appears in our catalog under these names: 2-Nitropyridin-4-ol, 95%, 2-Nitropyridin-4-ol, 2-Nitropyridin-4-ol, 97%, 97%, 2-Nitropyridin-4-ol, 97%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 25g, 5g, 250mg, 50mg, 100mg.
2-nitro-1H-pyridin-4-one (CAS 101654-28-8) is a chemical compound with the molecular formula C5H4N2O3 and a molecular weight of 140.10 g/mol. IUPAC name: 2-nitro-1H-pyridin-4-one. InChIKey: NJTUZNXKDOUPHP-UHFFFAOYSA-N.
| Molecular formula | C5H4N2O3 |
|---|---|
| Molecular weight | 140.10 g/mol |
| IUPAC name | 2-nitro-1H-pyridin-4-one |
| InChIKey | NJTUZNXKDOUPHP-UHFFFAOYSA-N |
| SMILES | C1=CNC(=CC1=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)