CAS 213113-45-2 appears in our catalog under these names: 6-Nitropyridin-2-ol 97%, 6-Nitropyridin-2-ol, 98%, 6-Nitropyridin-2(1h)-one, 95%, 6-Nitro-2(1H)-pyridinone, 97%, 97%. Offered by: Ambeed, Fluorochem, Combi-blocks, Chemat. Available pack sizes: 100mg, 250mg, 1g.
6-nitro-1H-pyridin-2-one (CAS 213113-45-2) is a chemical compound with the molecular formula C5H4N2O3 and a molecular weight of 140.10 g/mol. IUPAC name: 6-nitro-1H-pyridin-2-one. InChIKey: XVVDYCAYALHWBJ-UHFFFAOYSA-N.
| Molecular formula | C5H4N2O3 |
|---|---|
| Molecular weight | 140.10 g/mol |
| IUPAC name | 6-nitro-1H-pyridin-2-one |
| InChIKey | XVVDYCAYALHWBJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)NC(=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)