Products 1124-33-0
CAS 1124-33-0 appears in our catalog under these names: 4-Nitropyridine n-oxide, 98%, 4-Nitropyridine N-Oxide, 4–Nitropyridine N–oxide, 4-Nitropyridine N-oxide, 97% , 4-Nitropyridine N-Oxide, >98.0%(T). Offered by: Combi-blocks, TRC, GLPBio, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 100g, 1kg, 25g, 5g, 500g, 10g, 1g.
4-nitro-1-oxidopyridin-1-ium (CAS 1124-33-0) is a chemical compound with the molecular formula C5H4N2O3 and a molecular weight of 140.10 g/mol. IUPAC name: 4-nitro-1-oxidopyridin-1-ium. InChIKey: RXKNNAKAVAHBNK-UHFFFAOYSA-N.
| Molecular formula | C5H4N2O3 |
|---|---|
| Molecular weight | 140.10 g/mol |
| IUPAC name | 4-nitro-1-oxidopyridin-1-ium |
| InChIKey | RXKNNAKAVAHBNK-UHFFFAOYSA-N |
| SMILES | C1=C[N+](=CC=C1[N+](=O)[O-])[O-] |
Computed by PubChem (NCBI)