CAS 13505-06-1 appears in our catalog under these names: 3-Hydroxy-4-nitropyridine, 96%, 4-Nitropyridin-3-ol, 96%, 96%, 4-Nitropyridin-3-ol, 96%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg, 10g.
4-nitropyridin-3-ol (CAS 13505-06-1) is a chemical compound with the molecular formula C5H4N2O3 and a molecular weight of 140.10 g/mol. IUPAC name: 4-nitropyridin-3-ol. InChIKey: BVXHEFWTMMZHDG-UHFFFAOYSA-N.
| Molecular formula | C5H4N2O3 |
|---|---|
| Molecular weight | 140.10 g/mol |
| IUPAC name | 4-nitropyridin-3-ol |
| InChIKey | BVXHEFWTMMZHDG-UHFFFAOYSA-N |
| SMILES | C1=CN=CC(=C1[N+](=O)[O-])O |
Computed by PubChem (NCBI)