CAS 15590-90-6 appears in our catalog under these names: 3-Nitro-1h-pyridin-4-one, 98%, 4-Hydroxy-3-nitropyridine, 98%, 3–Nitro–1H–pyridin–4–one, 3-Nitropyridin-4(1H)-one, 3-Nitro-1H-pyridin-4-one 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 100g, 25g, 500g, 2,5g, 0,25g.
3-nitro-1H-pyridin-4-one (CAS 15590-90-6) is a chemical compound with the molecular formula C5H4N2O3 and a molecular weight of 140.10 g/mol. IUPAC name: 3-nitro-1H-pyridin-4-one. InChIKey: YUWOLBZMQDGRFV-UHFFFAOYSA-N.
| Molecular formula | C5H4N2O3 |
|---|---|
| Molecular weight | 140.10 g/mol |
| IUPAC name | 3-nitro-1H-pyridin-4-one |
| InChIKey | YUWOLBZMQDGRFV-UHFFFAOYSA-N |
| SMILES | C1=CNC=C(C1=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)