cas: 14316-61-1 — see every product listed under this CAS number, including other names
2-Phenoxyacetic anhydride 98% (CAS 14316-61-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A741212-1g |
| cas | 14316-61-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 248.00 Pln | |
| Ambeed | 25g | 832.06 Pln | |
| Ambeed | 100g | 2345.06 Pln | |
| Ambeed | 500g | 3591.06 Pln | |
| Ambeed | 1000g | 6656.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A741212 |
(2-phenoxyacetyl) 2-phenoxyacetate (CAS 14316-61-1) is a chemical compound with the molecular formula C16H14O5 and a molecular weight of 286.28 g/mol. IUPAC name: (2-phenoxyacetyl) 2-phenoxyacetate. InChIKey: CCSBNBKMACZDGN-UHFFFAOYSA-N.
| Molecular formula | C16H14O5 |
|---|---|
| Molecular weight | 286.28 g/mol |
| IUPAC name | (2-phenoxyacetyl) 2-phenoxyacetate |
| InChIKey | CCSBNBKMACZDGN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OCC(=O)OC(=O)COC2=CC=CC=C2 |
Computed by PubChem (NCBI)