cas: 14316-61-1 — see every product listed under this CAS number, including other names
Phenoxyacetic Anhydride, >98.0%(T) (CAS 14316-61-1) is a chemical reagent available from Chemat. Available pack sizes: 25g, 250g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | P0111-25G |
| cas | 14316-61-1 |
| size | 25g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25g | 595.32 Pln | |
| TCI | 250g | 3653.85 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(T) |
(2-phenoxyacetyl) 2-phenoxyacetate (CAS 14316-61-1) is a chemical compound with the molecular formula C16H14O5 and a molecular weight of 286.28 g/mol. IUPAC name: (2-phenoxyacetyl) 2-phenoxyacetate. InChIKey: CCSBNBKMACZDGN-UHFFFAOYSA-N.
| Molecular formula | C16H14O5 |
|---|---|
| Molecular weight | 286.28 g/mol |
| IUPAC name | (2-phenoxyacetyl) 2-phenoxyacetate |
| InChIKey | CCSBNBKMACZDGN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OCC(=O)OC(=O)COC2=CC=CC=C2 |
Computed by PubChem (NCBI)