cas: 1131-33-5 — see every product listed under this CAS number, including other names
2-Phenylpyridine 1-Oxide, >98.0%(T)(HPLC) (CAS 1131-33-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | P2775-250MG |
| cas | 1131-33-5 |
| size | 250mg |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 250mg | 201.94 Pln | |
| TCI | 1g | 516.64 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(T)(HPLC) |
1-oxido-2-phenylpyridin-1-ium (CAS 1131-33-5) is a chemical compound with the molecular formula C11H9NO and a molecular weight of 171.19 g/mol. IUPAC name: 1-oxido-2-phenylpyridin-1-ium. InChIKey: MZBZERKDGUOLBE-UHFFFAOYSA-N.
| Molecular formula | C11H9NO |
|---|---|
| Molecular weight | 171.19 g/mol |
| IUPAC name | 1-oxido-2-phenylpyridin-1-ium |
| InChIKey | MZBZERKDGUOLBE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC=[N+]2[O-] |
Computed by PubChem (NCBI)