cas: 1823921-17-0 — see every product listed under this CAS number, including other names
2-Pyrazinecarboxylic acid, 5-amino-6-bromo-3-methyl-, methyl ester, 95%, 95% (CAS 1823921-17-0) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1134S1-50mg |
| cas | 1823921-17-0 |
| size | 50mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 1302.80 Pln | |
| Chemat | 100mg | 2474.00 Pln | |
| Chemat | 250mg | 3506.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl 5-amino-6-bromo-3-methylpyrazine-2-carboxylate (CAS 1823921-17-0) is a chemical compound with the molecular formula C7H8BrN3O2 and a molecular weight of 246.06 g/mol. IUPAC name: methyl 5-amino-6-bromo-3-methylpyrazine-2-carboxylate. InChIKey: VFSGCXINBAMREZ-UHFFFAOYSA-N.
| Molecular formula | C7H8BrN3O2 |
|---|---|
| Molecular weight | 246.06 g/mol |
| IUPAC name | methyl 5-amino-6-bromo-3-methylpyrazine-2-carboxylate |
| InChIKey | VFSGCXINBAMREZ-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(C(=N1)N)Br)C(=O)OC |
Computed by PubChem (NCBI)