Products 2920210-55-3
CAS 2920210-55-3 is the registry number for N-(5-Bromo-6-(hydroxymethyl)pyrazin-2-yl)acetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[5-bromo-6-(hydroxymethyl)pyrazin-2-yl]acetamide (CAS 2920210-55-3) is a chemical compound with the molecular formula C7H8BrN3O2 and a molecular weight of 246.06 g/mol. IUPAC name: N-[5-bromo-6-(hydroxymethyl)pyrazin-2-yl]acetamide. InChIKey: SWJCFAYQBWUTGB-UHFFFAOYSA-N.
| Molecular formula | C7H8BrN3O2 |
|---|---|
| Molecular weight | 246.06 g/mol |
| IUPAC name | N-[5-bromo-6-(hydroxymethyl)pyrazin-2-yl]acetamide |
| InChIKey | SWJCFAYQBWUTGB-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CN=C(C(=N1)CO)Br |
Computed by PubChem (NCBI)