Products 771579-78-3
CAS 771579-78-3 appears in our catalog under these names: Benzenemethanamine, 2-amino-3-bromo-5-nitro-, 2-(Aminomethyl)-6-bromo-4-nitroaniline, 95%. Offered by: Chemat, Combi-blocks. Available pack sizes: 1g, 250mg.
2-(aminomethyl)-6-bromo-4-nitroaniline (CAS 771579-78-3) is a chemical compound with the molecular formula C7H8BrN3O2 and a molecular weight of 246.06 g/mol. IUPAC name: 2-(aminomethyl)-6-bromo-4-nitroaniline. InChIKey: NILKDFOQJZBCKG-UHFFFAOYSA-N.
| Molecular formula | C7H8BrN3O2 |
|---|---|
| Molecular weight | 246.06 g/mol |
| IUPAC name | 2-(aminomethyl)-6-bromo-4-nitroaniline |
| InChIKey | NILKDFOQJZBCKG-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1CN)N)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)