CAS 26163-05-3 is the registry number for 3-Bromo-2-(N,N-dimethyl)amino-5-nitropyridine, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 100g, 1g.
3-bromo-N,N-dimethyl-5-nitropyridin-2-amine (CAS 26163-05-3) is a chemical compound with the molecular formula C7H8BrN3O2 and a molecular weight of 246.06 g/mol. IUPAC name: 3-bromo-N,N-dimethyl-5-nitropyridin-2-amine. InChIKey: MPBCWXXDYWCJSW-UHFFFAOYSA-N.
| Molecular formula | C7H8BrN3O2 |
|---|---|
| Molecular weight | 246.06 g/mol |
| IUPAC name | 3-bromo-N,N-dimethyl-5-nitropyridin-2-amine |
| InChIKey | MPBCWXXDYWCJSW-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(C=C(C=N1)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)