CAS 1040682-46-9 is the registry number for 5-bromo-N,N-dimethyl-3-nitropyridin-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
5-bromo-N,N-dimethyl-3-nitropyridin-2-amine (CAS 1040682-46-9) is a chemical compound with the molecular formula C7H8BrN3O2 and a molecular weight of 246.06 g/mol. IUPAC name: 5-bromo-N,N-dimethyl-3-nitropyridin-2-amine. InChIKey: SZNVATVPNHSUOD-UHFFFAOYSA-N.
| Molecular formula | C7H8BrN3O2 |
|---|---|
| Molecular weight | 246.06 g/mol |
| IUPAC name | 5-bromo-N,N-dimethyl-3-nitropyridin-2-amine |
| InChIKey | SZNVATVPNHSUOD-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(C=C(C=N1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)