CAS 607371-01-7 appears in our catalog under these names: 3-Bromo-n-ethyl-5-nitropyridin-4-amine, 95%, 3-Bromo-N-ethyl-5-nitropyridin-4-amine. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 250mg, 1g, 5g.
3-bromo-N-ethyl-5-nitropyridin-4-amine (CAS 607371-01-7) is a chemical compound with the molecular formula C7H8BrN3O2 and a molecular weight of 246.06 g/mol. IUPAC name: 3-bromo-N-ethyl-5-nitropyridin-4-amine. InChIKey: DCRXFLDXMBGJNE-UHFFFAOYSA-N.
| Molecular formula | C7H8BrN3O2 |
|---|---|
| Molecular weight | 246.06 g/mol |
| IUPAC name | 3-bromo-N-ethyl-5-nitropyridin-4-amine |
| InChIKey | DCRXFLDXMBGJNE-UHFFFAOYSA-N |
| SMILES | CCNC1=C(C=NC=C1[N+](=O)[O-])Br |
Computed by PubChem (NCBI)