cas: 1003589-78-3 — see every product listed under this CAS number, including other names
2-Pyridineacetic acid, 3-(ethoxycarbonyl)-6-methoxy-α-methyl-, ethyl ester, 95%, 95% (CAS 1003589-78-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DUCL-100mg |
| cas | 1003589-78-3 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1096.40 Pln | |
| Chemat | 250mg | 1994.00 Pln | |
| Chemat | 1g | 4336.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2-(1-ethoxy-1-oxopropan-2-yl)-6-methoxypyridine-3-carboxylate (CAS 1003589-78-3) is a chemical compound with the molecular formula C14H19NO5 and a molecular weight of 281.30 g/mol. IUPAC name: ethyl 2-(1-ethoxy-1-oxopropan-2-yl)-6-methoxypyridine-3-carboxylate. InChIKey: FWOKSSFABOOZSU-UHFFFAOYSA-N.
| Molecular formula | C14H19NO5 |
|---|---|
| Molecular weight | 281.30 g/mol |
| IUPAC name | ethyl 2-(1-ethoxy-1-oxopropan-2-yl)-6-methoxypyridine-3-carboxylate |
| InChIKey | FWOKSSFABOOZSU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C(C=C1)OC)C(C)C(=O)OCC |
Computed by PubChem (NCBI)