cas: 20235-78-3 — see every product listed under this CAS number, including other names
2-Thiouridine, 97%, 97% (CAS 20235-78-3) is a chemical reagent available from Chemat. Available pack sizes: 20mg, 100mg, 500mg, 1g, 5g, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113986-20mg |
| cas | 20235-78-3 |
| size | 20mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 20mg | 93.20 Pln | |
| Chemat | 100mg | 184.40 Pln | |
| Chemat | 500mg | 539.60 Pln | |
| Chemat | 1g | 885.20 Pln | |
| Chemat | 5g | 2963.60 Pln | |
| Chemat | 250mg | 366.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-thiouridine is a thiouridine in which the oxygen replaced by sulfur is that at C-2. It is a thiouridine and a nucleoside analogue.
Source: ChEBI
| Molecular formula | C9H12N2O5S |
|---|---|
| Molecular weight | 260.27 g/mol |
| IUPAC name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-sulfanylidenepyrimidin-4-one |
| InChIKey | GJTBSTBJLVYKAU-XVFCMESISA-N |
| SMILES | C1=CN(C(=S)NC1=O)[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O |
Computed by PubChem (NCBI)