CAS 80036-92-6 is the registry number for Amisulpride Impurity 27. Offered by: Chemat Brand. Available pack sizes: on request.
5-ethylsulfonyl-2-methoxy-4-nitroaniline (CAS 80036-92-6) is a chemical compound with the molecular formula C9H12N2O5S and a molecular weight of 260.27 g/mol. IUPAC name: 5-ethylsulfonyl-2-methoxy-4-nitroaniline. InChIKey: VDDVUNNQSIPZIU-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O5S |
|---|---|
| Molecular weight | 260.27 g/mol |
| IUPAC name | 5-ethylsulfonyl-2-methoxy-4-nitroaniline |
| InChIKey | VDDVUNNQSIPZIU-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)C1=C(C=C(C(=C1)N)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)