CAS 2752754-93-9 is the registry number for N-(6-methoxy-2-methyl-3-nitrophenyl)methanesulfonamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
N-(6-methoxy-2-methyl-3-nitrophenyl)methanesulfonamide (CAS 2752754-93-9) is a chemical compound with the molecular formula C9H12N2O5S and a molecular weight of 260.27 g/mol. IUPAC name: N-(6-methoxy-2-methyl-3-nitrophenyl)methanesulfonamide. InChIKey: SQGJRSBHXJOHQI-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O5S |
|---|---|
| Molecular weight | 260.27 g/mol |
| IUPAC name | N-(6-methoxy-2-methyl-3-nitrophenyl)methanesulfonamide |
| InChIKey | SQGJRSBHXJOHQI-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1NS(=O)(=O)C)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)