cas: 89642-24-0 — see every product listed under this CAS number, including other names
2-aMino-5-broMo-4-nitrobenzoic acid, 96%, 96% (CAS 89642-24-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IFSE-100mg |
| cas | 89642-24-0 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 338.00 Pln | |
| Chemat | 250mg | 534.80 Pln | |
| Chemat | 1g | 1192.40 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
2-amino-5-bromo-4-nitrobenzoic acid (CAS 89642-24-0) is a chemical compound with the molecular formula C7H5BrN2O4 and a molecular weight of 261.03 g/mol. IUPAC name: 2-amino-5-bromo-4-nitrobenzoic acid. InChIKey: SZJSDVMUPOFTCD-UHFFFAOYSA-N.
| Molecular formula | C7H5BrN2O4 |
|---|---|
| Molecular weight | 261.03 g/mol |
| IUPAC name | 2-amino-5-bromo-4-nitrobenzoic acid |
| InChIKey | SZJSDVMUPOFTCD-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Br)[N+](=O)[O-])N)C(=O)O |
Computed by PubChem (NCBI)