CAS 1361385-86-5 appears in our catalog under these names: Methyl 2-bromo-5-nitroisonicotinate, 95%, Methyl 2-bromo-5-nitropyridine-4-carboxylate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 100mg.
Methyl 2-bromo-5-nitropyridine-4-carboxylate (CAS 1361385-86-5) is a chemical compound with the molecular formula C7H5BrN2O4 and a molecular weight of 261.03 g/mol. IUPAC name: methyl 2-bromo-5-nitropyridine-4-carboxylate. InChIKey: JVSYSLJNDBKBOH-UHFFFAOYSA-N.
| Molecular formula | C7H5BrN2O4 |
|---|---|
| Molecular weight | 261.03 g/mol |
| IUPAC name | methyl 2-bromo-5-nitropyridine-4-carboxylate |
| InChIKey | JVSYSLJNDBKBOH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=NC=C1[N+](=O)[O-])Br |
Computed by PubChem (NCBI)