CAS 95192-64-6 appears in our catalog under these names: 5-Bromo-2-methyl-1,3-dinitrobenzene, 97%, 4-Bromo-2,6-dinitrotoluene, 97% , 4-Bromo-2,6-dinitrotoluene, 97%, 5-Bromo-2-methyl-1,3-dinitrobenzene, 95%. Offered by: AmBeed, Thermo Scientific (Alfa Aesar), Thermo Scientific (Acros), Fluorochem. Available pack sizes: 250mg, 100mg, 5g, 1g, 10g, 25g, 100g, 500g.
5-bromo-2-methyl-1,3-dinitrobenzene (CAS 95192-64-6) is a chemical compound with the molecular formula C7H5BrN2O4 and a molecular weight of 261.03 g/mol. IUPAC name: 5-bromo-2-methyl-1,3-dinitrobenzene. InChIKey: UOGCLPDKGPPDHM-UHFFFAOYSA-N.
| Molecular formula | C7H5BrN2O4 |
|---|---|
| Molecular weight | 261.03 g/mol |
| IUPAC name | 5-bromo-2-methyl-1,3-dinitrobenzene |
| InChIKey | UOGCLPDKGPPDHM-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1[N+](=O)[O-])Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)