cas: 89642-24-0 — see every product listed under this CAS number, including other names
2-Amino-5-bromo-4-nitrobenzoic acid, 95% (CAS 89642-24-0) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A601530-10g |
| cas | 89642-24-0 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 10186.54 Pln | |
| AmBeed | 5g | 6417.25 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-amino-5-bromo-4-nitrobenzoic acid (CAS 89642-24-0) is a chemical compound with the molecular formula C7H5BrN2O4 and a molecular weight of 261.03 g/mol. IUPAC name: 2-amino-5-bromo-4-nitrobenzoic acid. InChIKey: SZJSDVMUPOFTCD-UHFFFAOYSA-N.
| Molecular formula | C7H5BrN2O4 |
|---|---|
| Molecular weight | 261.03 g/mol |
| IUPAC name | 2-amino-5-bromo-4-nitrobenzoic acid |
| InChIKey | SZJSDVMUPOFTCD-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Br)[N+](=O)[O-])N)C(=O)O |
Computed by PubChem (NCBI)