Products 860182-17-8
CAS 860182-17-8 is the registry number for 4-Amino-2-bromo-5-nitro-benzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
4-amino-2-bromo-5-nitrobenzoic acid (CAS 860182-17-8) is a chemical compound with the molecular formula C7H5BrN2O4 and a molecular weight of 261.03 g/mol. IUPAC name: 4-amino-2-bromo-5-nitrobenzoic acid. InChIKey: LHFYPZKFBRCWJU-UHFFFAOYSA-N.
| Molecular formula | C7H5BrN2O4 |
|---|---|
| Molecular weight | 261.03 g/mol |
| IUPAC name | 4-amino-2-bromo-5-nitrobenzoic acid |
| InChIKey | LHFYPZKFBRCWJU-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1[N+](=O)[O-])N)Br)C(=O)O |
Computed by PubChem (NCBI)