CAS 89642-24-0 appears in our catalog under these names: 2-Amino-5-bromo-4-nitro-benzoic acid, 95%, 2-Amino-5-bromo-4-nitrobenzoic acid, 95%, 2–aMino–5–broMo–4–nitrobenzoic acid, 2-Amino-5-bromo-4-nitrobenzoic acid 96%, 2-aMino-5-broMo-4-nitrobenzoic acid, 96%, 96%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 10g, 1g, 5g, 250mg, 100mg.
2-amino-5-bromo-4-nitrobenzoic acid (CAS 89642-24-0) is a chemical compound with the molecular formula C7H5BrN2O4 and a molecular weight of 261.03 g/mol. IUPAC name: 2-amino-5-bromo-4-nitrobenzoic acid. InChIKey: SZJSDVMUPOFTCD-UHFFFAOYSA-N.
| Molecular formula | C7H5BrN2O4 |
|---|---|
| Molecular weight | 261.03 g/mol |
| IUPAC name | 2-amino-5-bromo-4-nitrobenzoic acid |
| InChIKey | SZJSDVMUPOFTCD-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Br)[N+](=O)[O-])N)C(=O)O |
Computed by PubChem (NCBI)