cas: 15965-55-6 — see every product listed under this CAS number, including other names
2-chloro-4-nitro-1H-1,3-benzodiazole, 98% (CAS 15965-55-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F689962-100MG |
| cas | 15965-55-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 185.37 Pln | |
| Fluorochem | 250mg | 362.39 Pln | |
| Fluorochem | 1g | 1294.35 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-chloro-4-nitro-1H-benzimidazole (CAS 15965-55-6) is a chemical compound with the molecular formula C7H4ClN3O2 and a molecular weight of 197.58 g/mol. IUPAC name: 2-chloro-4-nitro-1H-benzimidazole. InChIKey: IDHWSFVCVDTHNI-UHFFFAOYSA-N.
| Molecular formula | C7H4ClN3O2 |
|---|---|
| Molecular weight | 197.58 g/mol |
| IUPAC name | 2-chloro-4-nitro-1H-benzimidazole |
| InChIKey | IDHWSFVCVDTHNI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)[N+](=O)[O-])N=C(N2)Cl |
Computed by PubChem (NCBI)