cas: 84865-19-0 — see every product listed under this CAS number, including other names
2H-1-Benzopyran-2-one, 7-(diethylamino)-3-phenyl- (CAS 84865-19-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GPDD-100mg |
| cas | 84865-19-0 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 222.80 Pln | |
| Chemat | 1g | 400.40 Pln | |
| Chemat | 5g | 1086.80 Pln | |
| Chemat | 25g | 5080.40 Pln |
| delivery time | 3 weeks |
|---|
7-(diethylamino)-3-phenylchromen-2-one (CAS 84865-19-0) is a chemical compound with the molecular formula C19H19NO2 and a molecular weight of 293.4 g/mol. IUPAC name: 7-(diethylamino)-3-phenylchromen-2-one. InChIKey: PSJYODMHCCQXQB-UHFFFAOYSA-N.
| Molecular formula | C19H19NO2 |
|---|---|
| Molecular weight | 293.4 g/mol |
| IUPAC name | 7-(diethylamino)-3-phenylchromen-2-one |
| InChIKey | PSJYODMHCCQXQB-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC2=C(C=C1)C=C(C(=O)O2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)