CAS 339107-43-6 is the registry number for (4E)-4-[(Dimethylamino)methylidene]-2,2-diphenyloxolan-3-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(4E)-4-(dimethylaminomethylidene)-2,2-diphenyloxolan-3-one (CAS 339107-43-6) is a chemical compound with the molecular formula C19H19NO2 and a molecular weight of 293.4 g/mol. IUPAC name: (4E)-4-(dimethylaminomethylidene)-2,2-diphenyloxolan-3-one. InChIKey: CKPDBTWWNMYQLO-FYWRMAATSA-N.
| Molecular formula | C19H19NO2 |
|---|---|
| Molecular weight | 293.4 g/mol |
| IUPAC name | (4E)-4-(dimethylaminomethylidene)-2,2-diphenyloxolan-3-one |
| InChIKey | CKPDBTWWNMYQLO-FYWRMAATSA-N |
| SMILES | CN(C)/C=C/1\COC(C1=O)(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)