CAS 1256627-81-2 is the registry number for 1-Benzoyl-2,2,4-trimethyl-1,2-dihydroquinolin-6-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(6-hydroxy-2,2,4-trimethylquinolin-1-yl)-phenylmethanone (CAS 1256627-81-2) is a chemical compound with the molecular formula C19H19NO2 and a molecular weight of 293.4 g/mol. IUPAC name: (6-hydroxy-2,2,4-trimethylquinolin-1-yl)-phenylmethanone. InChIKey: NUNWVAJLWKSEBW-UHFFFAOYSA-N.
| Molecular formula | C19H19NO2 |
|---|---|
| Molecular weight | 293.4 g/mol |
| IUPAC name | (6-hydroxy-2,2,4-trimethylquinolin-1-yl)-phenylmethanone |
| InChIKey | NUNWVAJLWKSEBW-UHFFFAOYSA-N |
| SMILES | CC1=CC(N(C2=C1C=C(C=C2)O)C(=O)C3=CC=CC=C3)(C)C |
Computed by PubChem (NCBI)