CAS 125971-57-5 appears in our catalog under these names: 2-Benzylidene isobutyryl acetanilide, 98%, 2-Isobutyryl-N-phenyl-3-phenylacrylamide (E/Z mixture), 2-Benzylidene-4-methyl-3-oxo-N-phenylpentanamide, 2–Isobutyryl–N,3–Diphenylacrylamide, 2-Isobutyryl-N-phenyl-3-phenylacrylamide. Offered by: Combi-blocks, TRC, Mikromol, GLPBio, Biosynth. Available pack sizes: 100g, 5g, 25g, 1g, 10g, 25mg, 50g, 500g.
(2Z)-2-benzylidene-4-methyl-3-oxo-N-phenylpentanamide (CAS 125971-57-5) is a chemical compound with the molecular formula C19H19NO2 and a molecular weight of 293.4 g/mol. IUPAC name: (2Z)-2-benzylidene-4-methyl-3-oxo-N-phenylpentanamide. InChIKey: SMUFHBOCNIUNPT-LGMDPLHJSA-N.
| Molecular formula | C19H19NO2 |
|---|---|
| Molecular weight | 293.4 g/mol |
| IUPAC name | (2Z)-2-benzylidene-4-methyl-3-oxo-N-phenylpentanamide |
| InChIKey | SMUFHBOCNIUNPT-LGMDPLHJSA-N |
| SMILES | CC(C)C(=O)/C(=C/C1=CC=CC=C1)/C(=O)NC2=CC=CC=C2 |
Computed by PubChem (NCBI)