Products 265989-32-0
CAS 265989-32-0 appears in our catalog under these names: 2-Isobutyryl-n-phenyl-3-phenylacrylamide, 98%, 2-Isobutyryl-N-phenyl-3-phenylacrylamide. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 50mg, 5mg.
(2E)-2-benzylidene-4-methyl-3-oxo-N-(2,3,4,5,6-pentadeuteriophenyl)pentanamide (CAS 265989-32-0) is a chemical compound with the molecular formula C19H19NO2 and a molecular weight of 298.4 g/mol. IUPAC name: (2E)-2-benzylidene-4-methyl-3-oxo-N-(2,3,4,5,6-pentadeuteriophenyl)pentanamide. InChIKey: SMUFHBOCNIUNPT-ROOCWFLOSA-N.
| Molecular formula | C19H19NO2 |
|---|---|
| Molecular weight | 298.4 g/mol |
| IUPAC name | (2E)-2-benzylidene-4-methyl-3-oxo-N-(2,3,4,5,6-pentadeuteriophenyl)pentanamide |
| InChIKey | SMUFHBOCNIUNPT-ROOCWFLOSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])NC(=O)/C(=C/C2=CC=CC=C2)/C(=O)C(C)C)[2H])[2H] |
Computed by PubChem (NCBI)