CAS 849021-33-6 is the registry number for 2-(1,3-Benzoxazol-2-yl)-1-(4-tert-butylphenyl)ethanone, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g.
2-(1,3-benzoxazol-2-yl)-1-(4-tert-butylphenyl)ethanone (CAS 849021-33-6) is a chemical compound with the molecular formula C19H19NO2 and a molecular weight of 293.4 g/mol. IUPAC name: 2-(1,3-benzoxazol-2-yl)-1-(4-tert-butylphenyl)ethanone. InChIKey: ZEGSTFWPJWLKSN-UHFFFAOYSA-N.
| Molecular formula | C19H19NO2 |
|---|---|
| Molecular weight | 293.4 g/mol |
| IUPAC name | 2-(1,3-benzoxazol-2-yl)-1-(4-tert-butylphenyl)ethanone |
| InChIKey | ZEGSTFWPJWLKSN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C(=O)CC2=NC3=CC=CC=C3O2 |
Computed by PubChem (NCBI)