cas: 873056-62-3 — see every product listed under this CAS number, including other names
3',4'-DIFLUORO[1,1'-BIPHENYL]-2-AMINE, 98%, 98% (CAS 873056-62-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11H2W6-250mg |
| cas | 873056-62-3 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 568.40 Pln | |
| Chemat | 1g | 1418.00 Pln | |
| Chemat | 5g | 4134.80 Pln | |
| Chemat | 100mg | 342.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(3,4-difluorophenyl)aniline (CAS 873056-62-3) is a chemical compound with the molecular formula C12H9F2N and a molecular weight of 205.20 g/mol. IUPAC name: 2-(3,4-difluorophenyl)aniline. InChIKey: HFHHGKVFBPGNTR-UHFFFAOYSA-N.
| Molecular formula | C12H9F2N |
|---|---|
| Molecular weight | 205.20 g/mol |
| IUPAC name | 2-(3,4-difluorophenyl)aniline |
| InChIKey | HFHHGKVFBPGNTR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC(=C(C=C2)F)F)N |
Computed by PubChem (NCBI)