CAS 76838-89-6 is the registry number for 2',6'-Difluoro-(1,1'-biphenyl)-2-amine, 97%. Offered by: AmBeed. Available pack sizes: 1g.
2-(2,6-difluorophenyl)aniline (CAS 76838-89-6) is a chemical compound with the molecular formula C12H9F2N and a molecular weight of 205.20 g/mol. IUPAC name: 2-(2,6-difluorophenyl)aniline. InChIKey: DXMJVEDCYGZYQB-UHFFFAOYSA-N.
| Molecular formula | C12H9F2N |
|---|---|
| Molecular weight | 205.20 g/mol |
| IUPAC name | 2-(2,6-difluorophenyl)aniline |
| InChIKey | DXMJVEDCYGZYQB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=C(C=CC=C2F)F)N |
Computed by PubChem (NCBI)