cas: 873056-62-3 — see every product listed under this CAS number, including other names
3',4'-Difluoro-[1,1'-biphenyl]-2-amine 98% (CAS 873056-62-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A334217-100mg |
| cas | 873056-62-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 448.25 Pln | |
| Ambeed | 250mg | 754.19 Pln | |
| Ambeed | 1g | 1916.75 Pln | |
| Ambeed | 5g | 5615.81 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A334217 |
2-(3,4-difluorophenyl)aniline (CAS 873056-62-3) is a chemical compound with the molecular formula C12H9F2N and a molecular weight of 205.20 g/mol. IUPAC name: 2-(3,4-difluorophenyl)aniline. InChIKey: HFHHGKVFBPGNTR-UHFFFAOYSA-N.
| Molecular formula | C12H9F2N |
|---|---|
| Molecular weight | 205.20 g/mol |
| IUPAC name | 2-(3,4-difluorophenyl)aniline |
| InChIKey | HFHHGKVFBPGNTR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC(=C(C=C2)F)F)N |
Computed by PubChem (NCBI)