CAS 55519-22-7 appears in our catalog under these names: 3,3,3-Trifluoro-2-hydroxy-2-phenylpropanoic acid, 95%, 3,3,3-Trifluoro-2-hydroxy-2-phenylpropanoic acid, 3,3,3-Trifluoro-2-hydroxy-2-phenylpropanoic acid, 95%, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 0,5g, 50mg, 100mg.
3,3,3-trifluoro-2-hydroxy-2-phenylpropanoic acid (CAS 55519-22-7) is a chemical compound with the molecular formula C9H7F3O3 and a molecular weight of 220.14 g/mol. IUPAC name: 3,3,3-trifluoro-2-hydroxy-2-phenylpropanoic acid. InChIKey: XXYXYHGJDXFJPH-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O3 |
|---|---|
| Molecular weight | 220.14 g/mol |
| IUPAC name | 3,3,3-trifluoro-2-hydroxy-2-phenylpropanoic acid |
| InChIKey | XXYXYHGJDXFJPH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(=O)O)(C(F)(F)F)O |
Computed by PubChem (NCBI)