CAS 17257-70-4 is the registry number for (R)-3,3,3-Trifluoro-2-hydroxy-2-phenylpropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-3,3,3-trifluoro-2-hydroxy-2-phenylpropanoic acid (CAS 17257-70-4) is a chemical compound with the molecular formula C9H7F3O3 and a molecular weight of 220.14 g/mol. IUPAC name: (2R)-3,3,3-trifluoro-2-hydroxy-2-phenylpropanoic acid. InChIKey: XXYXYHGJDXFJPH-MRVPVSSYSA-N.
| Molecular formula | C9H7F3O3 |
|---|---|
| Molecular weight | 220.14 g/mol |
| IUPAC name | (2R)-3,3,3-trifluoro-2-hydroxy-2-phenylpropanoic acid |
| InChIKey | XXYXYHGJDXFJPH-MRVPVSSYSA-N |
| SMILES | C1=CC=C(C=C1)[C@@](C(=O)O)(C(F)(F)F)O |
Computed by PubChem (NCBI)