cas: 4521-61-3 — see every product listed under this CAS number, including other names
3,4,5-Trimethoxybenzoyl Chloride, >97.0%(T) (CAS 4521-61-3) is a chemical reagent available from Chemat. Available pack sizes: 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | T1842-25G |
| cas | 4521-61-3 |
| size | 25g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25g | 411.44 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >97.0%(T) |
3,4,5-trimethoxybenzoyl chloride (CAS 4521-61-3) is a chemical compound with the molecular formula C10H11ClO4 and a molecular weight of 230.64 g/mol. IUPAC name: 3,4,5-trimethoxybenzoyl chloride. InChIKey: BUHYMJLFRZAFBF-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO4 |
|---|---|
| Molecular weight | 230.64 g/mol |
| IUPAC name | 3,4,5-trimethoxybenzoyl chloride |
| InChIKey | BUHYMJLFRZAFBF-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1OC)OC)C(=O)Cl |
Computed by PubChem (NCBI)