CAS 175136-01-3 appears in our catalog under these names: Methyl 2-chloro-3,4-dimethoxybenzoate, 98%, Methyl 2-chloro-3,4-dimethoxybenzoate, 97% . Offered by: Combi-blocks, Thermo Scientific. Available pack sizes: 10g, 5g, 1g, 25g.
Methyl 2-chloro-3,4-dimethoxybenzoate (CAS 175136-01-3) is a chemical compound with the molecular formula C10H11ClO4 and a molecular weight of 230.64 g/mol. IUPAC name: methyl 2-chloro-3,4-dimethoxybenzoate. InChIKey: RYYAHUFRPCBHCT-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO4 |
|---|---|
| Molecular weight | 230.64 g/mol |
| IUPAC name | methyl 2-chloro-3,4-dimethoxybenzoate |
| InChIKey | RYYAHUFRPCBHCT-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)C(=O)OC)Cl)OC |
Computed by PubChem (NCBI)