CAS 103040-51-3 appears in our catalog under these names: 2-Chloro-1-(2-hydroxy-4,6-dimethoxyphenyl)ethanone, 95%, 2–CHLORO–1–(2–HYDROXY–4,6–DIMETHOXYPHENYL)ETHANONE. Offered by: Combi-blocks, GLPBio. Available pack sizes: 100mg, 250mg.
2-chloro-1-(2-hydroxy-4,6-dimethoxyphenyl)ethanone (CAS 103040-51-3) is a chemical compound with the molecular formula C10H11ClO4 and a molecular weight of 230.64 g/mol. IUPAC name: 2-chloro-1-(2-hydroxy-4,6-dimethoxyphenyl)ethanone. InChIKey: YYZOHIUWSIOMEW-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO4 |
|---|---|
| Molecular weight | 230.64 g/mol |
| IUPAC name | 2-chloro-1-(2-hydroxy-4,6-dimethoxyphenyl)ethanone |
| InChIKey | YYZOHIUWSIOMEW-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)OC)C(=O)CCl)O |
Computed by PubChem (NCBI)