Products 142688-96-8

CAS 142688-96-8 is the registry number for 2-(2-Chloro-3,5-dimethoxyphenyl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-(2-chloro-3,5-dimethoxyphenyl)acetic acid (CAS 142688-96-8) is a chemical compound with the molecular formula C10H11ClO4 and a molecular weight of 230.64 g/mol. IUPAC name: 2-(2-chloro-3,5-dimethoxyphenyl)acetic acid. InChIKey: MKLNSUKJSLVVBX-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11ClO4
Molecular weight230.64 g/mol
IUPAC name2-(2-chloro-3,5-dimethoxyphenyl)acetic acid
InChIKeyMKLNSUKJSLVVBX-UHFFFAOYSA-N
SMILESCOC1=CC(=C(C(=C1)OC)Cl)CC(=O)O

Computed by PubChem (NCBI)