CAS 4521-61-3 appears in our catalog under these names: 3,4,5-Trimethoxybenzoyl chloride, 97%, 3,4,5-Trimethoxybenzoyl Chloride, 3,4,5–Trimethoxybenzoyl Chloride, 3,4,5-Trimethoxybenzoyl Chloride, >97.0%(T). Offered by: Combi-blocks, Chemat Brand, TRC, GLPBio, Biosynth. Available pack sizes: 25g, 100g, on request, 5g, 500g, 50g, 10g.
3,4,5-trimethoxybenzoyl chloride (CAS 4521-61-3) is a chemical compound with the molecular formula C10H11ClO4 and a molecular weight of 230.64 g/mol. IUPAC name: 3,4,5-trimethoxybenzoyl chloride. InChIKey: BUHYMJLFRZAFBF-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO4 |
|---|---|
| Molecular weight | 230.64 g/mol |
| IUPAC name | 3,4,5-trimethoxybenzoyl chloride |
| InChIKey | BUHYMJLFRZAFBF-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1OC)OC)C(=O)Cl |
Computed by PubChem (NCBI)